What is the 2-DODECEN-1-YLSUCCINIC ANHYDRIDE?

2-DODECEN-1-YLSUCCINIC ANHYDRIDE is colourless to light yellow viscous liquid, while it's Molecular Formula is C16H26O3. colourless to light yellow viscous liquid (2-Dodecen-1-yl)succinic anhydride may be used in the following:Synthesis of amphiphilic N-[(2'-(dodec-2'-en-10-yl)succinoyl]chitosan.Chemical modification of sago starch, via esterification.Preparation of dodecenyl succinic anhydride (DDSA) gum arabic derivatives, via chemical modification of gum arabic.

What is the CAS number for 2-DODECEN-1-YLSUCCINIC ANHYDRIDE?

The CAS number of 2-DODECEN-1-YLSUCCINIC ANHYDRIDE is 19780-11-1.

What is 2-DODECEN-1-YLSUCCINIC ANHYDRIDE (19780-11-1) used for?

2-DODECEN-1-YLSUCCINIC ANHYDRIDE, also known as DDSA, is a light yellow clear viscous oil with chemical properties ranging from colorless to light yellow. It is an organic compound that has found various applications in different industries due to its unique chemical structure and properties.InChI:InChI=1/C16H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-13-15(17)19-16(14)18/h10-11,14H,2-9,12-13H2,1H3

What is the 2-DODECEN-1-YLSUCCINIC ANHYDRIDE?

2-DODECEN-1-YLSUCCINIC ANHYDRIDE is colourless to light yellow viscous liquid, while it's Molecular Formula is C16H26O3. colourless to light yellow viscous liquid (2-Dodecen-1-yl)succinic anhydride may be used in the following:Synthesis of amphiphilic N-[(2′-(dodec-2′-en-10-yl)succinoyl]chitosan.Chemical modification of sago starch, via esterification.Preparation of dodecenyl succinic anhydride (DDSA) gum arabic derivatives, via chemical modification of gum arabic.

What is the CAS number for 2-DODECEN-1-YLSUCCINIC ANHYDRIDE?

The CAS number of 2-DODECEN-1-YLSUCCINIC ANHYDRIDE is 19780-11-1.

What is 2-DODECEN-1-YLSUCCINIC ANHYDRIDE (19780-11-1) used for?

2-DODECEN-1-YLSUCCINIC ANHYDRIDE, also known as DDSA, is a light yellow clear viscous oil with chemical properties ranging from colorless to light yellow. It is an organic compound that has found various applications in different industries due to its unique chemical structure and properties.InChI:InChI=1/C16H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-13-15(17)19-16(14)18/h10-11,14H,2-9,12-13H2,1H3